C16H11NO2 — CID 126367090
(E)-2-(1,3-benzodioxol-5-yl)-3-phenylprop-2-enenitrile (PubChem CID 126367090) has the molecular formula C16H11NO2 and a molecular weight of 249.27 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-yl)-3-phenylprop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzodioxol-5-yl)-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 126367090 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-yl)-3-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11NO2/c17-10-14(8-12-4-2-1-3-5-12)13-6-7-15-16(9-13)19-11-18-15/h1-9H,11H2/b14-8- |
| InChIKey | ICWQGOMFJVJGBD-ZSOIEALJSA-N |
| XLogP | 3.48 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|