C16H10ClNO2 — CID 51059850
(E)-3-(1,3-benzodioxol-5-yl)-2-(2-chlorophenyl)prop-2-enenitrile (PubChem CID 51059850) has the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-(2-chlorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-(2-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 51059850 |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-(2-chlorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc2c(c1)OCO2)c1ccccc1Cl |
| InChI | InChI=1S/C16H10ClNO2/c17-14-4-2-1-3-13(14)12(9-18)7-11-5-6-15-16(8-11)20-10-19-15/h1-8H,10H2/b12-7- |
| InChIKey | WSHYMOXWSMESML-GHXNOFRVSA-N |
| XLogP | 4.13 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|