C16H12N2O2 — CID 6109259
(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-pyridin-2-ylprop-2-enenitrile (PubChem CID 6109259) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-pyridin-2-ylprop-2-enenitrile.
| Compound Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 6109259 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-pyridin-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCCO2)c1ccccn1 |
| InChI | InChI=1S/C16H12N2O2/c17-11-13(14-3-1-2-6-18-14)9-12-4-5-15-16(10-12)20-8-7-19-15/h1-6,9-10H,7-8H2/b13-9+ |
| InChIKey | KTGKYIXRSKLNLT-UKTHLTGXSA-N |
| XLogP | 2.92 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|