C20H16N6O2 — CID 17461536
(E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enenitrile (PubChem CID 17461536) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 17461536 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (E)-2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCCO2)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H16N6O2/c21-12-14(10-13-6-7-16-17(11-13)28-9-8-27-16)18-24-19(22)26-20(25-18)23-15-4-2-1-3-5-15/h1-7,10-11H,8-9H2,(H3,22,23,24,25,26)/b14-10+ |
| InChIKey | ZGUPLYPREFLHMS-GXDHUFHOSA-N |
| XLogP | 3.03 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|