C17H10N2O3 — CID 5472680
(E)-3-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)prop-2-enenitrile (PubChem CID 5472680) has the molecular formula C17H10N2O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5472680 |
| Molecular Formula | C17H10N2O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCO2)c1nc2ccccc2o1 |
| InChI | InChI=1S/C17H10N2O3/c18-9-12(17-19-13-3-1-2-4-14(13)22-17)7-11-5-6-15-16(8-11)21-10-20-15/h1-8H,10H2/b12-7+ |
| InChIKey | BPZPZKCKVQEXLM-KPKJPENVSA-N |
| XLogP | 3.62 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|