C26H16N6O2 — CID 1115503
(E)-2-(1,3-benzoxazol-2-yl)-3-[3-[[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]anilino]prop-2-enenitrile (PubChem CID 1115503) has the molecular formula C26H16N6O2 and a molecular weight of 444.45 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-yl)-3-[3-[[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]anilino]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzoxazol-2-yl)-3-[3-[[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 1115503 |
| Molecular Formula | C26H16N6O2 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-yl)-3-[3-[[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]anilino]prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1cccc(N/C=C(\C#N)c2nc3ccccc3o2)c1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C26H16N6O2/c27-13-17(25-31-21-8-1-3-10-23(21)33-25)15-29-19-6-5-7-20(12-19)30-16-18(14-28)26-32-22-9-2-4-11-24(22)34-26/h1-12,15-16,29-30H/b17-15+,18-16+ |
| InChIKey | LCJPAOYMEFTEIF-YTEMWHBBSA-N |
| XLogP | 5.92 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|