C16H10N2O3 — CID 135451442
2,2-bis(1,3-benzoxazol-2-yl)ethenol (PubChem CID 135451442) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2,2-bis(1,3-benzoxazol-2-yl)ethenol.
| Compound Name | 2,2-bis(1,3-benzoxazol-2-yl)ethenol |
|---|---|
| PubChem CID | 135451442 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2,2-bis(1,3-benzoxazol-2-yl)ethenol |
| SMILES | OC=C(c1nc2ccccc2o1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H10N2O3/c19-9-10(15-17-11-5-1-3-7-13(11)20-15)16-18-12-6-2-4-8-14(12)21-16/h1-9,19H |
| InChIKey | VIFINGWMTQXWAV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|