C13H13NO2 — CID 123987728
(Z)-4-(1,3-benzoxazol-2-yl)hex-4-en-3-one (PubChem CID 123987728) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (Z)-4-(1,3-benzoxazol-2-yl)hex-4-en-3-one.
| Compound Name | (Z)-4-(1,3-benzoxazol-2-yl)hex-4-en-3-one |
|---|---|
| PubChem CID | 123987728 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (Z)-4-(1,3-benzoxazol-2-yl)hex-4-en-3-one |
| SMILES | C/C=C(\C(=O)CC)c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H13NO2/c1-3-9(11(15)4-2)13-14-10-7-5-6-8-12(10)16-13/h3,5-8H,4H2,1-2H3/b9-3+ |
| InChIKey | BTCOHIFQQYVELU-YCRREMRBSA-N |
| XLogP | 3.21 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|