C13H13NO2S — CID 89207810
(Z)-3-(1,3-benzoxazol-2-yl)-5-sulfanylhex-3-en-2-one (PubChem CID 89207810) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is (Z)-3-(1,3-benzoxazol-2-yl)-5-sulfanylhex-3-en-2-one.
| Compound Name | (Z)-3-(1,3-benzoxazol-2-yl)-5-sulfanylhex-3-en-2-one |
|---|---|
| PubChem CID | 89207810 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (Z)-3-(1,3-benzoxazol-2-yl)-5-sulfanylhex-3-en-2-one |
| SMILES | CC(=O)/C(=C\C(C)S)c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H13NO2S/c1-8(17)7-10(9(2)15)13-14-11-5-3-4-6-12(11)16-13/h3-8,17H,1-2H3/b10-7+ |
| InChIKey | VHLKGFVVPQYSKY-JXMROGBWSA-N |
| XLogP | 3.12 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|