C22H17NO3 — CID 70457087
ethyl (Z)-2-(1,3-benzoxazol-2-yl)-3-naphthalen-1-ylprop-2-enoate (PubChem CID 70457087) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is ethyl (Z)-2-(1,3-benzoxazol-2-yl)-3-naphthalen-1-ylprop-2-enoate.
| Compound Name | ethyl (Z)-2-(1,3-benzoxazol-2-yl)-3-naphthalen-1-ylprop-2-enoate |
|---|---|
| PubChem CID | 70457087 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | ethyl (Z)-2-(1,3-benzoxazol-2-yl)-3-naphthalen-1-ylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1cccc2ccccc12)c1nc2ccccc2o1 |
| InChI | InChI=1S/C22H17NO3/c1-2-25-22(24)18(21-23-19-12-5-6-13-20(19)26-21)14-16-10-7-9-15-8-3-4-11-17(15)16/h3-14H,2H2,1H3/b18-14- |
| InChIKey | JIXQWCNALZDZCO-JXAWBTAJSA-N |
| XLogP | 5.08 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|