About diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde
diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde (PubChem CID 161000803) has the molecular formula C29H26O5
and a molecular weight of 454.52 g/mol. Its IUPAC name is diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde.
Molecular Properties
| Compound Name | diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde |
| PubChem CID | 161000803 |
| Molecular Formula | C29H26O5 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde |
| SMILES | CCOC(=O)C(=Cc1cccc2ccccc12)C(=O)OCC.O=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C18H18O4.C11H8O/c1-3-21-17(19)16(18(20)22-4-2)12-14-10-7-9-13-8-5-6-11-15(13)14;12-8-10-6-3-5-9-4-1-2-7-11(9)10/h5-12H,3-4H2,1-2H3;1-8H |
| InChIKey | TVVPFEDDELGAJK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde?
The IUPAC name of diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde (CID 161000803) is diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde.
What is the SMILES notation for diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde?
The canonical SMILES for diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde is CCOC(=O)C(=Cc1cccc2ccccc12)C(=O)OCC.O=Cc1cccc2ccccc12.
What is the InChIKey of diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde?
The InChIKey is TVVPFEDDELGAJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4.C11H8O/c1-3-21-17(19)16(18(20)22-4-2)12-14-10-7-9-13-8-5-6-11-15(13)14;12-8-10-6-3-5-9-4-1-2-7-11(9)10/h5-12H,3-4H2,1-2H3;1-8H.
What are the key properties of diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde?
diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde has a molecular weight of 454.52 g/mol, XLogP of 6.00, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(naphthalen-1-ylmethylidene)propanedioate;naphthalene-1-carbaldehyde is sourced from PubChem (CID 161000803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).