C17H16O4 — CID 54320420
4-ethoxy-2-(naphthalen-1-ylmethylidene)-4-oxobutanoic acid (PubChem CID 54320420) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-ethoxy-2-(naphthalen-1-ylmethylidene)-4-oxobutanoic acid.
| Compound Name | 4-ethoxy-2-(naphthalen-1-ylmethylidene)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54320420 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-ethoxy-2-(naphthalen-1-ylmethylidene)-4-oxobutanoic acid |
| SMILES | CCOC(=O)CC(=Cc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H16O4/c1-2-21-16(18)11-14(17(19)20)10-13-8-5-7-12-6-3-4-9-15(12)13/h3-10H,2,11H2,1H3,(H,19,20) |
| InChIKey | SRGCUPSJOZTFAY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|