About diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate
diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate (PubChem CID 12529566) has the molecular formula C15H16N2O5
and a molecular weight of 304.30 g/mol. Its IUPAC name is diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate |
| PubChem CID | 12529566 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1nc2ccccc2o1)C(=O)OCC |
| InChI | InChI=1S/C15H16N2O5/c1-3-20-13(18)10(14(19)21-4-2)9-16-15-17-11-7-5-6-8-12(11)22-15/h5-9H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | PAERLUSDWNIPGD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate?
The IUPAC name of diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate (CID 12529566) is diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate.
What is the SMILES notation for diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate?
The canonical SMILES for diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate is CCOC(=O)C(=CNc1nc2ccccc2o1)C(=O)OCC.
What is the InChIKey of diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate?
The InChIKey is PAERLUSDWNIPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O5/c1-3-20-13(18)10(14(19)21-4-2)9-16-15-17-11-7-5-6-8-12(11)22-15/h5-9H,3-4H2,1-2H3,(H,16,17).
What are the key properties of diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate?
diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate has a molecular weight of 304.30 g/mol, XLogP of 2.25, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(1,3-benzoxazol-2-ylamino)methylidene]propanedioate is sourced from PubChem (CID 12529566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).