About 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate
1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate (PubChem CID 640725) has the molecular formula C14H16N2O5
and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate.
Analyze 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate?
The IUPAC name of 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate (CID 640725) is 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate.
What is the SMILES notation for 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate?
The canonical SMILES for 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate is CCOC(=O)[C@@H](CC(=O)OC)Nc1nc2ccccc2o1.
What is the InChIKey of 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate?
The InChIKey is RSOXLPAVLFQJNX-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H16N2O5/c1-3-20-13(18)10(8-12(17)19-2)16-14-15-9-6-4-5-7-11(9)21-14/h4-7,10H,3,8H2,1-2H3,(H,15,16)/t10-/m1/s1.
What are the key properties of 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate?
1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate has a molecular weight of 292.29 g/mol, XLogP of 1.73, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-methyl (2R)-2-(1,3-benzoxazol-2-ylamino)butanedioate is sourced from PubChem (CID 640725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).