C14H20N2O2 — CID 133311700
N-(1-methoxyhexan-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 133311700) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(1-methoxyhexan-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(1-methoxyhexan-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 133311700 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-(1-methoxyhexan-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | CCCCC(COC)Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H20N2O2/c1-3-4-7-11(10-17-2)15-14-16-12-8-5-6-9-13(12)18-14/h5-6,8-9,11H,3-4,7,10H2,1-2H3,(H,15,16) |
| InChIKey | AWYVGRNDPISXSO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |