About methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate
methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate (PubChem CID 44546117) has the molecular formula C13H14N4O5S
and a molecular weight of 338.35 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate |
| PubChem CID | 44546117 |
| Molecular Formula | C13H14N4O5S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@@H](CSN=O)Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H14N4O5S/c1-21-11(18)6-14-12(19)9(7-23-17-20)16-13-15-8-4-2-3-5-10(8)22-13/h2-5,9H,6-7H2,1H3,(H,14,19)(H,15,16)/t9-/m1/s1 |
| InChIKey | DTCYBDJDGMJLTL-SECBINFHSA-N |
| XLogP | 1.31 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate?
The IUPAC name of methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate (CID 44546117) is methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate.
What is the SMILES notation for methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate?
The canonical SMILES for methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate is COC(=O)CNC(=O)[C@@H](CSN=O)Nc1nc2ccccc2o1.
What is the InChIKey of methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate?
The InChIKey is DTCYBDJDGMJLTL-SECBINFHSA-N. The full InChI is InChI=1S/C13H14N4O5S/c1-21-11(18)6-14-12(19)9(7-23-17-20)16-13-15-8-4-2-3-5-10(8)22-13/h2-5,9H,6-7H2,1H3,(H,14,19)(H,15,16)/t9-/m1/s1.
What are the key properties of methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate?
methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate has a molecular weight of 338.35 g/mol, XLogP of 1.31, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S)-2-(1,3-benzoxazol-2-ylamino)-3-nitrososulfanylpropanoyl]amino]acetate is sourced from PubChem (CID 44546117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).