C18H18N2O4 — CID 133302692
methyl 4-[4-(1,3-benzoxazol-2-ylamino)phenoxy]butanoate (PubChem CID 133302692) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl 4-[4-(1,3-benzoxazol-2-ylamino)phenoxy]butanoate.
| Compound Name | methyl 4-[4-(1,3-benzoxazol-2-ylamino)phenoxy]butanoate |
|---|---|
| PubChem CID | 133302692 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | methyl 4-[4-(1,3-benzoxazol-2-ylamino)phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(Nc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-22-17(21)7-4-12-23-14-10-8-13(9-11-14)19-18-20-15-5-2-3-6-16(15)24-18/h2-3,5-6,8-11H,4,7,12H2,1H3,(H,19,20) |
| InChIKey | JSTFOMKUSDKNMB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|