C26H25N3O5 — CID 18433368
methyl 4-[3-[[2-(2-anilino-1,3-benzoxazol-5-yl)acetyl]amino]phenoxy]butanoate (PubChem CID 18433368) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is methyl 4-[3-[[2-(2-anilino-1,3-benzoxazol-5-yl)acetyl]amino]phenoxy]butanoate.
| Compound Name | methyl 4-[3-[[2-(2-anilino-1,3-benzoxazol-5-yl)acetyl]amino]phenoxy]butanoate |
|---|---|
| PubChem CID | 18433368 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | methyl 4-[3-[[2-(2-anilino-1,3-benzoxazol-5-yl)acetyl]amino]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1cccc(NC(=O)Cc2ccc3oc(Nc4ccccc4)nc3c2)c1 |
| InChI | InChI=1S/C26H25N3O5/c1-32-25(31)11-6-14-33-21-10-5-9-20(17-21)27-24(30)16-18-12-13-23-22(15-18)29-26(34-23)28-19-7-3-2-4-8-19/h2-5,7-10,12-13,15,17H,6,11,14,16H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | FMEFKTVPQAAGQX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|