C26H25N3O5 — CID 68819554
4-[3-[3-(2-anilino-1,3-benzoxazol-6-yl)propanoylamino]phenoxy]butanoic acid (PubChem CID 68819554) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 4-[3-[3-(2-anilino-1,3-benzoxazol-6-yl)propanoylamino]phenoxy]butanoic acid.
| Compound Name | 4-[3-[3-(2-anilino-1,3-benzoxazol-6-yl)propanoylamino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 68819554 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 4-[3-[3-(2-anilino-1,3-benzoxazol-6-yl)propanoylamino]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(NC(=O)CCc2ccc3nc(Nc4ccccc4)oc3c2)c1 |
| InChI | InChI=1S/C26H25N3O5/c30-24(27-20-8-4-9-21(17-20)33-15-5-10-25(31)32)14-12-18-11-13-22-23(16-18)34-26(29-22)28-19-6-2-1-3-7-19/h1-4,6-9,11,13,16-17H,5,10,12,14-15H2,(H,27,30)(H,28,29)(H,31,32) |
| InChIKey | LSFSTMXFFDNMJQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|