C17H16N2O3 — CID 18008952
3-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]propanoic acid (PubChem CID 18008952) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]propanoic acid.
| Compound Name | 3-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]propanoic acid |
|---|---|
| PubChem CID | 18008952 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]propanoic acid |
| SMILES | Cc1ccccc1Nc1nc2ccc(CCC(=O)O)cc2o1 |
| InChI | InChI=1S/C17H16N2O3/c1-11-4-2-3-5-13(11)18-17-19-14-8-6-12(7-9-16(20)21)10-15(14)22-17/h2-6,8,10H,7,9H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | DWEQEAULNYFVCY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |