C16H15N3O2 — CID 89385713
1-[2-(2-aminoanilino)-1,3-benzoxazol-6-yl]propan-2-one (PubChem CID 89385713) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-[2-(2-aminoanilino)-1,3-benzoxazol-6-yl]propan-2-one.
| Compound Name | 1-[2-(2-aminoanilino)-1,3-benzoxazol-6-yl]propan-2-one |
|---|---|
| PubChem CID | 89385713 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[2-(2-aminoanilino)-1,3-benzoxazol-6-yl]propan-2-one |
| SMILES | CC(=O)Cc1ccc2nc(Nc3ccccc3N)oc2c1 |
| InChI | InChI=1S/C16H15N3O2/c1-10(20)8-11-6-7-14-15(9-11)21-16(19-14)18-13-5-3-2-4-12(13)17/h2-7,9H,8,17H2,1H3,(H,18,19) |
| InChIKey | XWLFUKLAYLHAFH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|