C34H35N3O4 — CID 69414328
3-[1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]-1,2,3,4,4a,5,6,7-octahydroisoquinolin-7-yl]-3-phenylpropanoic acid (PubChem CID 69414328) has the molecular formula C34H35N3O4 and a molecular weight of 549.67 g/mol. Its IUPAC name is 3-[1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]-1,2,3,4,4a,5,6,7-octahydroisoquinolin-7-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]-1,2,3,4,4a,5,6,7-octahydroisoquinolin-7-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 69414328 |
| Molecular Formula | C34H35N3O4 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 3-[1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]-1,2,3,4,4a,5,6,7-octahydroisoquinolin-7-yl]-3-phenylpropanoic acid |
| SMILES | Cc1ccccc1Nc1nc2ccc(CC(=O)C3NCCC4CCC(C(CC(=O)O)c5ccccc5)C=C43)cc2o1 |
| InChI | InChI=1S/C34H35N3O4/c1-21-7-5-6-10-28(21)36-34-37-29-14-11-22(18-31(29)41-34)17-30(38)33-27-19-25(13-12-24(27)15-16-35-33)26(20-32(39)40)23-8-3-2-4-9-23/h2-11,14,18-19,24-26,33,35H,12-13,15-17,20H2,1H3,(H,36,37)(H,39,40) |
| InChIKey | LGPNNYHRSRGGLY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|