C29H27N3O5 — CID 58778623
methyl 4-[[(2S)-1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]-2,5-dihydropyrrol-2-yl]methoxy]benzoate (PubChem CID 58778623) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is methyl 4-[[(2S)-1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]-2,5-dihydropyrrol-2-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[(2S)-1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]-2,5-dihydropyrrol-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 58778623 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | methyl 4-[[(2S)-1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]-2,5-dihydropyrrol-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OC[C@@H]2C=CCN2C(=O)Cc2ccc3nc(Nc4ccccc4C)oc3c2)cc1 |
| InChI | InChI=1S/C29H27N3O5/c1-19-6-3-4-8-24(19)30-29-31-25-14-9-20(16-26(25)37-29)17-27(33)32-15-5-7-22(32)18-36-23-12-10-21(11-13-23)28(34)35-2/h3-14,16,22H,15,17-18H2,1-2H3,(H,30,31)/t22-/m0/s1 |
| InChIKey | OOHXHXQBPTYTQM-QFIPXVFZSA-N |
| XLogP | 5.05 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|