C30H32N4O5 — CID 67405581
4-[dimethylamino-[(2S)-1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]pyrrolidin-2-yl]methoxy]benzoic acid (PubChem CID 67405581) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is 4-[dimethylamino-[(2S)-1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]pyrrolidin-2-yl]methoxy]benzoic acid.
| Compound Name | 4-[dimethylamino-[(2S)-1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]pyrrolidin-2-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 67405581 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 4-[dimethylamino-[(2S)-1-[2-[2-(2-methylanilino)-1,3-benzoxazol-6-yl]acetyl]pyrrolidin-2-yl]methoxy]benzoic acid |
| SMILES | Cc1ccccc1Nc1nc2ccc(CC(=O)N3CCC[C@H]3C(Oc3ccc(C(=O)O)cc3)N(C)C)cc2o1 |
| InChI | InChI=1S/C30H32N4O5/c1-19-7-4-5-8-23(19)31-30-32-24-15-10-20(17-26(24)39-30)18-27(35)34-16-6-9-25(34)28(33(2)3)38-22-13-11-21(12-14-22)29(36)37/h4-5,7-8,10-15,17,25,28H,6,9,16,18H2,1-3H3,(H,31,32)(H,36,37)/t25-,28?/m0/s1 |
| InChIKey | XITHPZBFJGMZBU-ALLRNTDFSA-N |
| XLogP | 5.08 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|