C13H10ClN3O — CID 79890014
2-N-(2-chlorophenyl)-1,3-benzoxazole-2,6-diamine (PubChem CID 79890014) has the molecular formula C13H10ClN3O and a molecular weight of 259.70 g/mol. Its IUPAC name is 2-N-(2-chlorophenyl)-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-(2-chlorophenyl)-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79890014 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-N-(2-chlorophenyl)-1,3-benzoxazole-2,6-diamine |
| SMILES | Nc1ccc2nc(Nc3ccccc3Cl)oc2c1 |
| InChI | InChI=1S/C13H10ClN3O/c14-9-3-1-2-4-10(9)16-13-17-11-6-5-8(15)7-12(11)18-13/h1-7H,15H2,(H,16,17) |
| InChIKey | JCUKQNZCAUBGDL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|