C16H12N4O — CID 79881931
2-N-quinolin-8-yl-1,3-benzoxazole-2,6-diamine (PubChem CID 79881931) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-N-quinolin-8-yl-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-quinolin-8-yl-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79881931 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-N-quinolin-8-yl-1,3-benzoxazole-2,6-diamine |
| SMILES | Nc1ccc2nc(Nc3cccc4cccnc34)oc2c1 |
| InChI | InChI=1S/C16H12N4O/c17-11-6-7-12-14(9-11)21-16(19-12)20-13-5-1-3-10-4-2-8-18-15(10)13/h1-9H,17H2,(H,19,20) |
| InChIKey | LKISXZRKXBYRKS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|