C14H12ClN3O — CID 79890897
2-N-(2-chloro-6-methylphenyl)-1,3-benzoxazole-2,5-diamine (PubChem CID 79890897) has the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-N-(2-chloro-6-methylphenyl)-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-(2-chloro-6-methylphenyl)-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 79890897 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-N-(2-chloro-6-methylphenyl)-1,3-benzoxazole-2,5-diamine |
| SMILES | Cc1cccc(Cl)c1Nc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C14H12ClN3O/c1-8-3-2-4-10(15)13(8)18-14-17-11-7-9(16)5-6-12(11)19-14/h2-7H,16H2,1H3,(H,17,18) |
| InChIKey | HPNOVWJTFLVQQB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|