C15H16N4O — CID 115376175
2-N-[3-(dimethylamino)phenyl]-1,3-benzoxazole-2,5-diamine (PubChem CID 115376175) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)phenyl]-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-[3-(dimethylamino)phenyl]-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 115376175 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-N-[3-(dimethylamino)phenyl]-1,3-benzoxazole-2,5-diamine |
| SMILES | CN(C)c1cccc(Nc2nc3cc(N)ccc3o2)c1 |
| InChI | InChI=1S/C15H16N4O/c1-19(2)12-5-3-4-11(9-12)17-15-18-13-8-10(16)6-7-14(13)20-15/h3-9H,16H2,1-2H3,(H,17,18) |
| InChIKey | OZXBRHXQWWYSBL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|