About 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine
2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine (PubChem CID 79884466) has the molecular formula C14H12FN3O
and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine |
| PubChem CID | 79884466 |
| Molecular Formula | C14H12FN3O |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine |
| SMILES | Cc1ccc(Nc2nc3cc(N)ccc3o2)cc1F |
| InChI | InChI=1S/C14H12FN3O/c1-8-2-4-10(7-11(8)15)17-14-18-12-6-9(16)3-5-13(12)19-14/h2-7H,16H2,1H3,(H,17,18) |
| InChIKey | YERANILETCUOBY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine?
The IUPAC name of 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine (CID 79884466) is 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine.
What is the SMILES notation for 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine?
The canonical SMILES for 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine is Cc1ccc(Nc2nc3cc(N)ccc3o2)cc1F.
What is the InChIKey of 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine?
The InChIKey is YERANILETCUOBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O/c1-8-2-4-10(7-11(8)15)17-14-18-12-6-9(16)3-5-13(12)19-14/h2-7H,16H2,1H3,(H,17,18).
What are the key properties of 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine?
2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine has a molecular weight of 257.27 g/mol, XLogP of 3.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3-fluoro-4-methylphenyl)-1,3-benzoxazole-2,5-diamine is sourced from PubChem (CID 79884466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).