C14H12BrN3O2 — CID 79890068
2-N-(3-bromo-4-methoxyphenyl)-1,3-benzoxazole-2,5-diamine (PubChem CID 79890068) has the molecular formula C14H12BrN3O2 and a molecular weight of 334.17 g/mol. Its IUPAC name is 2-N-(3-bromo-4-methoxyphenyl)-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-(3-bromo-4-methoxyphenyl)-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 79890068 |
| Molecular Formula | C14H12BrN3O2 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-N-(3-bromo-4-methoxyphenyl)-1,3-benzoxazole-2,5-diamine |
| SMILES | COc1ccc(Nc2nc3cc(N)ccc3o2)cc1Br |
| InChI | InChI=1S/C14H12BrN3O2/c1-19-12-5-3-9(7-10(12)15)17-14-18-11-6-8(16)2-4-13(11)20-14/h2-7H,16H2,1H3,(H,17,18) |
| InChIKey | LLJLQCFAOOWDTQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|