C14H11BrN2O2 — CID 54910238
2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-6-amine (PubChem CID 54910238) has the molecular formula C14H11BrN2O2 and a molecular weight of 319.16 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 54910238 |
| Molecular Formula | C14H11BrN2O2 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-6-amine |
| SMILES | COc1ccc(-c2nc3ccc(N)cc3o2)cc1Br |
| InChI | InChI=1S/C14H11BrN2O2/c1-18-12-5-2-8(6-10(12)15)14-17-11-4-3-9(16)7-13(11)19-14/h2-7H,16H2,1H3 |
| InChIKey | WRTKFLDZXQIKKX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|