C14H9Br3N2O2 — CID 50881708
4,6-dibromo-2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-5-amine (PubChem CID 50881708) has the molecular formula C14H9Br3N2O2 and a molecular weight of 476.95 g/mol. Its IUPAC name is 4,6-dibromo-2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-5-amine.
| Compound Name | 4,6-dibromo-2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 50881708 |
| Molecular Formula | C14H9Br3N2O2 |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 473.82 |
| IUPAC Name | 4,6-dibromo-2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-5-amine |
| SMILES | COc1ccc(-c2nc3c(Br)c(N)c(Br)cc3o2)cc1Br |
| InChI | InChI=1S/C14H9Br3N2O2/c1-20-9-3-2-6(4-7(9)15)14-19-13-10(21-14)5-8(16)12(18)11(13)17/h2-5H,18H2,1H3 |
| InChIKey | ANVJZXDQYPQQFW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|