C16H13Br2ClN2O2 — CID 91673542
4,6-dibromo-2-(3-chloro-4-methoxyphenyl)-7-ethyl-1,3-benzoxazol-5-amine (PubChem CID 91673542) has the molecular formula C16H13Br2ClN2O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is 4,6-dibromo-2-(3-chloro-4-methoxyphenyl)-7-ethyl-1,3-benzoxazol-5-amine.
| Compound Name | 4,6-dibromo-2-(3-chloro-4-methoxyphenyl)-7-ethyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 91673542 |
| Molecular Formula | C16H13Br2ClN2O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 457.90 |
| IUPAC Name | 4,6-dibromo-2-(3-chloro-4-methoxyphenyl)-7-ethyl-1,3-benzoxazol-5-amine |
| SMILES | CCc1c(Br)c(N)c(Br)c2nc(-c3ccc(OC)c(Cl)c3)oc12 |
| InChI | InChI=1S/C16H13Br2ClN2O2/c1-3-8-11(17)13(20)12(18)14-15(8)23-16(21-14)7-4-5-10(22-2)9(19)6-7/h4-6H,3,20H2,1-2H3 |
| InChIKey | HMHFIYAFXNJAHX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|