C15H13BrN2O2 — CID 91673892
2-(3-bromo-4-ethoxyphenyl)-1,3-benzoxazol-5-amine (PubChem CID 91673892) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is 2-(3-bromo-4-ethoxyphenyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(3-bromo-4-ethoxyphenyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 91673892 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(3-bromo-4-ethoxyphenyl)-1,3-benzoxazol-5-amine |
| SMILES | CCOc1ccc(-c2nc3cc(N)ccc3o2)cc1Br |
| InChI | InChI=1S/C15H13BrN2O2/c1-2-19-13-5-3-9(7-11(13)16)15-18-12-8-10(17)4-6-14(12)20-15/h3-8H,2,17H2,1H3 |
| InChIKey | KYURGSBEPYECRL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|