C15H14BrN3O — CID 91684318
2-[3-bromo-4-(dimethylamino)phenyl]-1,3-benzoxazol-5-amine (PubChem CID 91684318) has the molecular formula C15H14BrN3O and a molecular weight of 332.20 g/mol. Its IUPAC name is 2-[3-bromo-4-(dimethylamino)phenyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[3-bromo-4-(dimethylamino)phenyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 91684318 |
| Molecular Formula | C15H14BrN3O |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-[3-bromo-4-(dimethylamino)phenyl]-1,3-benzoxazol-5-amine |
| SMILES | CN(C)c1ccc(-c2nc3cc(N)ccc3o2)cc1Br |
| InChI | InChI=1S/C15H14BrN3O/c1-19(2)13-5-3-9(7-11(13)16)15-18-12-8-10(17)4-6-14(12)20-15/h3-8H,17H2,1-2H3 |
| InChIKey | AVKVYHDUJJJXPX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|