C11H7BrN2OS — CID 63797921
2-(3-bromothiophen-2-yl)-1,3-benzoxazol-5-amine (PubChem CID 63797921) has the molecular formula C11H7BrN2OS and a molecular weight of 295.16 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(3-bromothiophen-2-yl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 63797921 |
| Molecular Formula | C11H7BrN2OS |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(-c3sccc3Br)nc2c1 |
| InChI | InChI=1S/C11H7BrN2OS/c12-7-3-4-16-10(7)11-14-8-5-6(13)1-2-9(8)15-11/h1-5H,13H2 |
| InChIKey | RBNXHWSCNDTRGG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|