C11H6Br2N2OS — CID 114021263
2-(2,5-dibromothiophen-3-yl)-1,3-benzoxazol-5-amine (PubChem CID 114021263) has the molecular formula C11H6Br2N2OS and a molecular weight of 374.06 g/mol. Its IUPAC name is 2-(2,5-dibromothiophen-3-yl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(2,5-dibromothiophen-3-yl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 114021263 |
| Molecular Formula | C11H6Br2N2OS |
| Molecular Weight | 374.06 g/mol |
| Exact Mass | 371.86 |
| IUPAC Name | 2-(2,5-dibromothiophen-3-yl)-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(-c3cc(Br)sc3Br)nc2c1 |
| InChI | InChI=1S/C11H6Br2N2OS/c12-9-4-6(10(13)17-9)11-15-7-3-5(14)1-2-8(7)16-11/h1-4H,14H2 |
| InChIKey | BAVNFLUVLOOGRX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.06 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|