C14H12N2O2 — CID 136802404
2-(5-amino-1,3-benzoxazol-2-yl)-5-methylphenol (PubChem CID 136802404) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(5-amino-1,3-benzoxazol-2-yl)-5-methylphenol.
| Compound Name | 2-(5-amino-1,3-benzoxazol-2-yl)-5-methylphenol |
|---|---|
| PubChem CID | 136802404 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(5-amino-1,3-benzoxazol-2-yl)-5-methylphenol |
| SMILES | Cc1ccc(-c2nc3cc(N)ccc3o2)c(O)c1 |
| InChI | InChI=1S/C14H12N2O2/c1-8-2-4-10(12(17)6-8)14-16-11-7-9(15)3-5-13(11)18-14/h2-7,17H,15H2,1H3 |
| InChIKey | KVRPNJULNLEHIX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|