C21H15N3O4 — CID 157482621
2-(5-amino-1,3-benzoxazol-2-yl)-5-(5-methyl-1,3-benzoxazol-2-yl)benzene-1,4-diol (PubChem CID 157482621) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-(5-amino-1,3-benzoxazol-2-yl)-5-(5-methyl-1,3-benzoxazol-2-yl)benzene-1,4-diol.
| Compound Name | 2-(5-amino-1,3-benzoxazol-2-yl)-5-(5-methyl-1,3-benzoxazol-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 157482621 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(5-amino-1,3-benzoxazol-2-yl)-5-(5-methyl-1,3-benzoxazol-2-yl)benzene-1,4-diol |
| SMILES | Cc1ccc2oc(-c3cc(O)c(-c4nc5cc(N)ccc5o4)cc3O)nc2c1 |
| InChI | InChI=1S/C21H15N3O4/c1-10-2-4-18-14(6-10)23-20(27-18)12-8-17(26)13(9-16(12)25)21-24-15-7-11(22)3-5-19(15)28-21/h2-9,25-26H,22H2,1H3 |
| InChIKey | RKIYFGLCRHIICU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|