C20H10Br2N2O4 — CID 142681394
2,5-bis(5-bromo-1,3-benzoxazol-2-yl)benzene-1,4-diol (PubChem CID 142681394) has the molecular formula C20H10Br2N2O4 and a molecular weight of 502.12 g/mol. Its IUPAC name is 2,5-bis(5-bromo-1,3-benzoxazol-2-yl)benzene-1,4-diol.
| Compound Name | 2,5-bis(5-bromo-1,3-benzoxazol-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 142681394 |
| Molecular Formula | C20H10Br2N2O4 |
| Molecular Weight | 502.12 g/mol |
| Exact Mass | 499.90 |
| IUPAC Name | 2,5-bis(5-bromo-1,3-benzoxazol-2-yl)benzene-1,4-diol |
| SMILES | Oc1cc(-c2nc3cc(Br)ccc3o2)c(O)cc1-c1nc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C20H10Br2N2O4/c21-9-1-3-17-13(5-9)23-19(27-17)11-7-16(26)12(8-15(11)25)20-24-14-6-10(22)2-4-18(14)28-20/h1-8,25-26H |
| InChIKey | NXDVSVYBGYJKMK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.12 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|