C21H15BrN2O2 — CID 1125948
4-bromo-2-[[2-(2-methylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol (PubChem CID 1125948) has the molecular formula C21H15BrN2O2 and a molecular weight of 407.27 g/mol. Its IUPAC name is 4-bromo-2-[[2-(2-methylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol.
| Compound Name | 4-bromo-2-[[2-(2-methylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 1125948 |
| Molecular Formula | C21H15BrN2O2 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 4-bromo-2-[[2-(2-methylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol |
| SMILES | Cc1ccccc1-c1nc2cc(/N=C/c3cc(Br)ccc3O)ccc2o1 |
| InChI | InChI=1S/C21H15BrN2O2/c1-13-4-2-3-5-17(13)21-24-18-11-16(7-9-20(18)26-21)23-12-14-10-15(22)6-8-19(14)25/h2-12,25H,1H3/b23-12+ |
| InChIKey | DPTSNODHCXUMQH-FSJBWODESA-N |
| XLogP | 6.02 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|