C20H12FN3O4 — CID 1085263
2-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-nitrophenol (PubChem CID 1085263) has the molecular formula C20H12FN3O4 and a molecular weight of 377.33 g/mol. Its IUPAC name is 2-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-nitrophenol.
| Compound Name | 2-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 1085263 |
| Molecular Formula | C20H12FN3O4 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/c2ccc3oc(-c4ccccc4F)nc3c2)c1 |
| InChI | InChI=1S/C20H12FN3O4/c21-16-4-2-1-3-15(16)20-23-17-10-13(5-8-19(17)28-20)22-11-12-9-14(24(26)27)6-7-18(12)25/h1-11,25H/b22-11+ |
| InChIKey | IMNPUSLEMBYLJN-SSDVNMTOSA-N |
| XLogP | 5.00 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|