C15H14N2O2 — CID 115411925
5-methoxy-2-(5-methyl-1,3-benzoxazol-2-yl)aniline (PubChem CID 115411925) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-methoxy-2-(5-methyl-1,3-benzoxazol-2-yl)aniline.
| Compound Name | 5-methoxy-2-(5-methyl-1,3-benzoxazol-2-yl)aniline |
|---|---|
| PubChem CID | 115411925 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-methoxy-2-(5-methyl-1,3-benzoxazol-2-yl)aniline |
| SMILES | COc1ccc(-c2nc3cc(C)ccc3o2)c(N)c1 |
| InChI | InChI=1S/C15H14N2O2/c1-9-3-6-14-13(7-9)17-15(19-14)11-5-4-10(18-2)8-12(11)16/h3-8H,16H2,1-2H3 |
| InChIKey | GWZSKXQQTQDEAG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|