C14H11IN2O2 — CID 102696756
4-iodo-2-(5-methoxy-1,3-benzoxazol-2-yl)aniline (PubChem CID 102696756) has the molecular formula C14H11IN2O2 and a molecular weight of 366.16 g/mol. Its IUPAC name is 4-iodo-2-(5-methoxy-1,3-benzoxazol-2-yl)aniline.
| Compound Name | 4-iodo-2-(5-methoxy-1,3-benzoxazol-2-yl)aniline |
|---|---|
| PubChem CID | 102696756 |
| Molecular Formula | C14H11IN2O2 |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 4-iodo-2-(5-methoxy-1,3-benzoxazol-2-yl)aniline |
| SMILES | COc1ccc2oc(-c3cc(I)ccc3N)nc2c1 |
| InChI | InChI=1S/C14H11IN2O2/c1-18-9-3-5-13-12(7-9)17-14(19-13)10-6-8(15)2-4-11(10)16/h2-7H,16H2,1H3 |
| InChIKey | GNONOMVWBZHITL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|