C16H15NO3 — CID 91684024
2-(2,5-dimethoxyphenyl)-5-methyl-1,3-benzoxazole (PubChem CID 91684024) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-5-methyl-1,3-benzoxazole.
| Compound Name | 2-(2,5-dimethoxyphenyl)-5-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 91684024 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-5-methyl-1,3-benzoxazole |
| SMILES | COc1ccc(OC)c(-c2nc3cc(C)ccc3o2)c1 |
| InChI | InChI=1S/C16H15NO3/c1-10-4-6-15-13(8-10)17-16(20-15)12-9-11(18-2)5-7-14(12)19-3/h4-9H,1-3H3 |
| InChIKey | DDQSGQCVIHQLAH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |