C13H21NO2 — CID 145041643
ethane;5-methoxy-2-methyl-1,3-benzoxazole (PubChem CID 145041643) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;5-methoxy-2-methyl-1,3-benzoxazole.
| Compound Name | ethane;5-methoxy-2-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 145041643 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethane;5-methoxy-2-methyl-1,3-benzoxazole |
| SMILES | CC.CC.COc1ccc2oc(C)nc2c1 |
| InChI | InChI=1S/C9H9NO2.2C2H6/c1-6-10-8-5-7(11-2)3-4-9(8)12-6;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | OUMJQIZEVURZNT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |