C8H7NO2 — CID 10888073
2-methyl-1,3-benzoxazol-5-ol (PubChem CID 10888073) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 2-methyl-1,3-benzoxazol-5-ol.
| Compound Name | 2-methyl-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 10888073 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2-methyl-1,3-benzoxazol-5-ol |
| SMILES | Cc1nc2cc(O)ccc2o1 |
| InChI | InChI=1S/C8H7NO2/c1-5-9-7-4-6(10)2-3-8(7)11-5/h2-4,10H,1H3 |
| InChIKey | VWFUDKCJVNWDPI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |