C8H5F2NO2 — CID 118843102
2-(difluoromethyl)-1,3-benzoxazol-5-ol (PubChem CID 118843102) has the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,3-benzoxazol-5-ol.
| Compound Name | 2-(difluoromethyl)-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 118843102 |
| Molecular Formula | C8H5F2NO2 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 2-(difluoromethyl)-1,3-benzoxazol-5-ol |
| SMILES | Oc1ccc2oc(C(F)F)nc2c1 |
| InChI | InChI=1S/C8H5F2NO2/c9-7(10)8-11-5-3-4(12)1-2-6(5)13-8/h1-3,7,12H |
| InChIKey | LYZFZENNKONSTH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |