C14H15NO6 — CID 70191318
[acetyloxy-(5-hydroxy-1,3-benzoxazol-2-yl)methyl] butanoate (PubChem CID 70191318) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is [acetyloxy-(5-hydroxy-1,3-benzoxazol-2-yl)methyl] butanoate.
| Compound Name | [acetyloxy-(5-hydroxy-1,3-benzoxazol-2-yl)methyl] butanoate |
|---|---|
| PubChem CID | 70191318 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | [acetyloxy-(5-hydroxy-1,3-benzoxazol-2-yl)methyl] butanoate |
| SMILES | CCCC(=O)OC(OC(C)=O)c1nc2cc(O)ccc2o1 |
| InChI | InChI=1S/C14H15NO6/c1-3-4-12(18)21-14(19-8(2)16)13-15-10-7-9(17)5-6-11(10)20-13/h5-7,14,17H,3-4H2,1-2H3 |
| InChIKey | AMIXBHBNDMRDNS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|