C10H7NO4 — CID 135435078
(Z)-3-(1,3-benzoxazol-2-yl)-2-hydroxyprop-2-enoic acid (PubChem CID 135435078) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is (Z)-3-(1,3-benzoxazol-2-yl)-2-hydroxyprop-2-enoic acid.
| Compound Name | (Z)-3-(1,3-benzoxazol-2-yl)-2-hydroxyprop-2-enoic acid |
|---|---|
| PubChem CID | 135435078 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | (Z)-3-(1,3-benzoxazol-2-yl)-2-hydroxyprop-2-enoic acid |
| SMILES | O=C(O)/C(O)=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C10H7NO4/c12-7(10(13)14)5-9-11-6-3-1-2-4-8(6)15-9/h1-5,12H,(H,13,14)/b7-5- |
| InChIKey | KHMKFDNDGVXSJQ-ALCCZGGFSA-N |
| XLogP | 1.81 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|